|
CAS#: 548475-54-3 Product: 1,3-Dimethyl-1,5-Dihydro-2H-Cyclohepta[4,5]Furo[2,3-d]Pyrimidine-2,4(3H)-Dione No suppilers available for the product. |
| Name | 1,3-Dimethyl-1,5-Dihydro-2H-Cyclohepta[4,5]Furo[2,3-d]Pyrimidine-2,4(3H)-Dione |
|---|---|
| Synonyms | 1,3-Dimet |
| Molecular Structure | ![]() |
| Molecular Formula | C13H12N2O3 |
| Molecular Weight | 244.25 |
| CAS Registry Number | 548475-54-3 |
| SMILES | Cn1c(=O)c2c3c(oc2n(c1=O)C)C=CC=CC3 |
| InChI | 1S/C13H12N2O3/c1-14-11(16)10-8-6-4-3-5-7-9(8)18-12(10)15(2)13(14)17/h3-5,7H,6H2,1-2H3 |
| InChIKey | PMFVKYZSIQRJSN-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 444.8±55.0°C at 760 mmHg (Cal.) |
| Flash point | 222.8±31.5°C (Cal.) |
| Refractive index | 1.602 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3-Dimethyl-1,5-Dihydro-2H-Cyclohepta[4,5]Furo[2,3-d]Pyrimidine-2,4(3H)-Dione |