|
CAS#: 54890-04-9 Product: 2,2'-[(2,2,2-Trichloroethylidene)Bis(Oxy)]Bisbutane No suppilers available for the product. |
| Name | 2,2'-[(2,2,2-Trichloroethylidene)Bis(Oxy)]Bisbutane |
|---|---|
| Synonyms | 2-(2,2,2-Trichloro-1-Sec-Butoxy-Ethoxy)Butane; 2-(2,2,2-Trichloro-1-Sec-Butoxyethoxy)Butane; 2-(1-Butan-2-Yloxy-2,2,2-Trichloro-Ethoxy)Butane |
| Molecular Structure | ![]() |
| Molecular Formula | C10H19Cl3O2 |
| Molecular Weight | 277.62 |
| CAS Registry Number | 54890-04-9 |
| SMILES | C(C(OC(C(Cl)(Cl)Cl)OC(C)CC)C)C |
| InChI | 1S/C10H19Cl3O2/c1-5-7(3)14-9(10(11,12)13)15-8(4)6-2/h7-9H,5-6H2,1-4H3 |
| InChIKey | DKYJZZXSBAPULJ-UHFFFAOYSA-N |
| Density | 1.149g/cm3 (Cal.) |
|---|---|
| Boiling point | 285.909°C at 760 mmHg (Cal.) |
| Flash point | 87.068°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2'-[(2,2,2-Trichloroethylidene)Bis(Oxy)]Bisbutane |