|
CAS#: 54932-87-5 Product: 1-(2-Methylprop-2-Enoxy)-4-Tert-Butyl-Benzene No suppilers available for the product. |
| Name | 1-(2-Methylprop-2-Enoxy)-4-Tert-Butyl-Benzene |
|---|---|
| Synonyms | 4-Tert-Butylphenyl 2-Methyl-2-Propenyl Ether; Benzene, 1-(1,1-Dimethylethyl)-4-[(2-Methyl-2-Propenyl)Oxy]-; Nsc403879 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H20O |
| Molecular Weight | 204.31 |
| CAS Registry Number | 54932-87-5 |
| SMILES | C1=C(C=CC(=C1)C(C)(C)C)OCC(=C)C |
| InChI | 1S/C14H20O/c1-11(2)10-15-13-8-6-12(7-9-13)14(3,4)5/h6-9H,1,10H2,2-5H3 |
| InChIKey | NYPZWJMIOKKCKE-UHFFFAOYSA-N |
| Density | 0.91g/cm3 (Cal.) |
|---|---|
| Boiling point | 281.27°C at 760 mmHg (Cal.) |
| Flash point | 108.151°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(2-Methylprop-2-Enoxy)-4-Tert-Butyl-Benzene |