|
CAS#: 5495-87-4 Product: 2-(Tert-Butyl)-9H-Thioxanthen-9-One No suppilers available for the product. |
| Name | 2-(Tert-Butyl)-9H-Thioxanthen-9-One |
|---|---|
| Synonyms | 3-Tert-Butyl-9-Thioxanthenone; 2-(Tert-Butyl)-9H-Thioxanthen-9-One |
| Molecular Structure | ![]() |
| Molecular Formula | C17H16OS |
| Molecular Weight | 268.37 |
| CAS Registry Number | 5495-87-4 |
| EINECS | 226-828-4 |
| SMILES | C1=C2C(=CC=C1C(C)(C)C)C(C3=C(S2)C=CC=C3)=O |
| InChI | 1S/C17H16OS/c1-17(2,3)11-8-9-13-15(10-11)19-14-7-5-4-6-12(14)16(13)18/h4-10H,1-3H3 |
| InChIKey | KFZOCFFWSYNXTH-UHFFFAOYSA-N |
| Density | 1.173g/cm3 (Cal.) |
|---|---|
| Boiling point | 403.876°C at 760 mmHg (Cal.) |
| Flash point | 216.606°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(Tert-Butyl)-9H-Thioxanthen-9-One |