|
CAS#: 54965-48-9 Product: 4,4-Dimethyl-1,1'-Bi(Cyclohexane)-1',3'-Diene-2,6-Dione No suppilers available for the product. |
| Name | 4,4-Dimethyl-1,1'-Bi(Cyclohexane)-1',3'-Diene-2,6-Dione |
|---|---|
| Synonyms | 2-(1,3-Cy |
| Molecular Structure | ![]() |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.29 |
| CAS Registry Number | 54965-48-9 |
| SMILES | O=C1C(C(=O)CC(C)(C)C1)\C2=C\C=C/CC2 |
| InChI | 1S/C14H18O2/c1-14(2)8-11(15)13(12(16)9-14)10-6-4-3-5-7-10/h3-4,6,13H,5,7-9H2,1-2H3 |
| InChIKey | PXMNXHKOWUDRHE-UHFFFAOYSA-N |
| Density | 1.078g/cm3 (Cal.) |
|---|---|
| Boiling point | 353.298°C at 760 mmHg (Cal.) |
| Flash point | 132.559°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,4-Dimethyl-1,1'-Bi(Cyclohexane)-1',3'-Diene-2,6-Dione |