Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (650) 278-9963 | |||
|
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Name | Barium Lactate |
|---|---|
| Synonyms | Barium(+2) Cation; Lactate; Barium Dilactate |
| Molecular Structure |  |
| Molecular Formula | C6H10BaO6 |
| Molecular Weight | 315.48 |
| CAS Registry Number | 54983-89-0 |
| EINECS | 259-425-7 |
| SMILES | CC(O)C([O-])=O.CC(O)C([O-])=O.[Ba++] |
| InChI | 1S/2C3H6O3.Ba/c2*1-2(4)3(5)6;/h2*2,4H,1H3,(H,5,6);/q;;+2/p-2 |
| InChIKey | HLKMEIITONDPGG-UHFFFAOYSA-L |
| Boiling point | 227.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 109.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Barium Lactate |