|
CAS#: 55000-46-9 Product: 2,4-Dimethylbenzyl 3,5-Dimethylbenzoate No suppilers available for the product. |
| Name | 2,4-Dimethylbenzyl 3,5-Dimethylbenzoate |
|---|---|
| Synonyms | 2,4-Dimethylbenzyl 3,5-dimethylbenzoate # |
| Molecular Structure | ![]() |
| Molecular Formula | C18H20O2 |
| Molecular Weight | 268.35 |
| CAS Registry Number | 55000-46-9 |
| SMILES | O=C(OCc1ccc(cc1C)C)c2cc(cc(c2)C)C |
| InChI | 1S/C18H20O2/c1-12-5-6-16(15(4)8-12)11-20-18(19)17-9-13(2)7-14(3)10-17/h5-10H,11H2,1-4H3 |
| InChIKey | IBRBFIYYVTXJDR-UHFFFAOYSA-N |
| Density | 1.06g/cm3 (Cal.) |
|---|---|
| Boiling point | 401.177°C at 760 mmHg (Cal.) |
| Flash point | 170.413°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4-Dimethylbenzyl 3,5-Dimethylbenzoate |