|
CAS#: 55030-66-5 Product: 3,5-Diacetyl-2,6-Dimethyltetrahydro-4H-Pyran-4-One No suppilers available for the product. |
| Name | 3,5-Diacetyl-2,6-Dimethyltetrahydro-4H-Pyran-4-One |
|---|---|
| Synonyms | 3,5-Diacetyl-2,6-dimethyltetrahydro-4H-pyran-4-one # |
| Molecular Structure | ![]() |
| Molecular Formula | C11H16O4 |
| Molecular Weight | 212.24 |
| CAS Registry Number | 55030-66-5 |
| SMILES | O=C(C1C(=O)C(C(=O)C)C(OC1C)C)C |
| InChI | 1S/C11H16O4/c1-5(12)9-7(3)15-8(4)10(6(2)13)11(9)14/h7-10H,1-4H3 |
| InChIKey | ONUGATOLIKUXKP-UHFFFAOYSA-N |
| Density | 1.08g/cm3 (Cal.) |
|---|---|
| Boiling point | 335.447°C at 760 mmHg (Cal.) |
| Flash point | 147.758°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,5-Diacetyl-2,6-Dimethyltetrahydro-4H-Pyran-4-One |