|
CAS#: 55044-42-3 Product: 5-(1-Cyclohexen-1-Yl)-1-Ethyl-3,5-Dimethyl-2,4,6(1H,3H,5H)-Pyrimidinetrione No suppilers available for the product. |
| Name | 5-(1-Cyclohexen-1-Yl)-1-Ethyl-3,5-Dimethyl-2,4,6(1H,3H,5H)-Pyrimidinetrione |
|---|---|
| Synonyms | 5-(1-Cycl |
| Molecular Structure | ![]() |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 |
| CAS Registry Number | 55044-42-3 |
| SMILES | O=C1N(C(=O)C(C(=O)N1C)(/C2=C/CCCC2)C)CC |
| InChI | 1S/C14H20N2O3/c1-4-16-12(18)14(2,10-8-6-5-7-9-10)11(17)15(3)13(16)19/h8H,4-7,9H2,1-3H3 |
| InChIKey | IAXQVVJGNSGULG-UHFFFAOYSA-N |
| Density | 1.172g/cm3 (Cal.) |
|---|---|
| Boiling point | 356.797°C at 760 mmHg (Cal.) |
| Flash point | 142.946°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-(1-Cyclohexen-1-Yl)-1-Ethyl-3,5-Dimethyl-2,4,6(1H,3H,5H)-Pyrimidinetrione |