|
CAS#: 55044-46-7 Product: 1,2-Dichloro-3,4-Bis(Dichloromethylene)Cyclobutane No suppilers available for the product. |
| Name | 1,2-Dichloro-3,4-Bis(Dichloromethylene)Cyclobutane |
|---|---|
| Synonyms | 1,2-Dichloro-3,4-Bis(Dichloromethylene)Cyclobutane; Cyclobutane, 1,2-Dichloro 3,4-Bis(Dichloromethylene)-; 1,2-Dichloro-3,4-Bis(Dichloromethylene)Cyclobu* |
| Molecular Structure | ![]() |
| Molecular Formula | C6H2Cl6 |
| Molecular Weight | 286.80 |
| CAS Registry Number | 55044-46-7 |
| SMILES | C(=C1C(C(Cl)C1=C(Cl)Cl)Cl)(Cl)Cl |
| InChI | 1S/C6H2Cl6/c7-3-1(5(9)10)2(4(3)8)6(11)12/h3-4H |
| InChIKey | BMOVIMWGAWTJDT-UHFFFAOYSA-N |
| Density | 1.726g/cm3 (Cal.) |
|---|---|
| Boiling point | 311.235°C at 760 mmHg (Cal.) |
| Flash point | 146.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2-Dichloro-3,4-Bis(Dichloromethylene)Cyclobutane |