|
CAS#: 55066-45-0 Product: 3-Methyl-5-Phenylpent-1-En-3-Ol No suppilers available for the product. |
| Name | 3-Methyl-5-Phenylpent-1-En-3-Ol |
|---|---|
| Synonyms | 3-Methyl-5-Phenyl-Pent-1-En-3-Ol; Benzenepropanol, Alpha-Ethenyl-Alpha-Methyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C12H16O |
| Molecular Weight | 176.26 |
| CAS Registry Number | 55066-45-0 |
| EINECS | 259-460-8 |
| SMILES | C1=CC=C(C=C1)CCC(O)(C=C)C |
| InChI | 1S/C12H16O/c1-3-12(2,13)10-9-11-7-5-4-6-8-11/h3-8,13H,1,9-10H2,2H3 |
| InChIKey | UWRYPWSHHZVMHR-UHFFFAOYSA-N |
| Density | 0.974g/cm3 (Cal.) |
|---|---|
| Boiling point | 281.464°C at 760 mmHg (Cal.) |
| Flash point | 117.208°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Methyl-5-Phenylpent-1-En-3-Ol |