|
CAS#: 55092-48-3 Product: 1,3-Dihydroxy-4-Methyl-9H-Xanthen-9-One No suppilers available for the product. |
| Name | 1,3-Dihydroxy-4-Methyl-9H-Xanthen-9-One |
|---|---|
| Synonyms | 1,3-Dihydroxy-4-methyl-9H-xanthen-9-one #; 1,3-Dihydroxy-4-methyl-xanthen-9-one |
| Molecular Structure | ![]() |
| Molecular Formula | C14H10O4 |
| Molecular Weight | 242.23 |
| CAS Registry Number | 55092-48-3 |
| SMILES | CC1=C2C(=C(C=C1O)O)C(=O)C3=CC=CC=C3O2 |
| InChI | 1S/C14H10O4/c1-7-9(15)6-10(16)12-13(17)8-4-2-3-5-11(8)18-14(7)12/h2-6,15-16H,1H3 |
| InChIKey | LETPFDPOVPABGM-UHFFFAOYSA-N |
| Density | 1.5±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 478.8±45.0°C at 760 mmHg (Cal.) |
| Flash point | 189.7±22.2°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3-Dihydroxy-4-Methyl-9H-Xanthen-9-One |