| Name | 1,2-Dihydroxy-4'-Chlorobiphenyl |
|---|---|
| Synonyms | 4-(4-Chlorophenyl)Pyrocatechol; (1,1'-Biphenyl)-3,4-Diol, 4'-Chloro-; 1,2-Dihydroxy-4'-Chlorobiphenyl |
| Molecular Structure | ![]() |
| Molecular Formula | C12H9ClO2 |
| Molecular Weight | 220.65 |
| CAS Registry Number | 55097-84-2 |
| SMILES | C1=CC(=CC=C1Cl)C2=CC(=C(C=C2)O)O |
| InChI | 1S/C12H9ClO2/c13-10-4-1-8(2-5-10)9-3-6-11(14)12(15)7-9/h1-7,14-15H |
| InChIKey | SCKSZDPELRSPES-UHFFFAOYSA-N |
| Density | 1.349g/cm3 (Cal.) |
|---|---|
| Boiling point | 392.59°C at 760 mmHg (Cal.) |
| Flash point | 191.232°C (Cal.) |
| (1) | H.-J. Lehmler, L. W. Robertson and S. Parkin. 4-Chloro-3',4'-dihydroxybiphenyl, Acta Cryst. (2001). E57, o590-o591 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1,2-Dihydroxy-4'-Chlorobiphenyl |