|
CAS#: 551-43-9 Product: 1,4:3,6-Dianhydro-D-Mannitol Dinitrate No suppilers available for the product. |
| Name | 1,4:3,6-Dianhydro-D-Mannitol Dinitrate |
|---|---|
| Synonyms | Nitric Acid [(3R,3As,6R,6As)-3-Nitrooxy-2,3,3A,5,6,6A-Hexahydrofuro[2,3-D]Furan-6-Yl] Ester; 1,4,3,6-Dianhydro-D-Mannitol Dinitrate; Isomannide Dinitrate |
| Molecular Structure | ![]() |
| Molecular Formula | C6H8N2O8 |
| Molecular Weight | 236.14 |
| CAS Registry Number | 551-43-9 |
| SMILES | [C@H]12OC[C@@H](O[N+]([O-])=O)[C@H]1OC[C@H]2O[N+]([O-])=O |
| InChI | 1S/C6H8N2O8/c9-7(10)15-3-1-13-6-4(16-8(11)12)2-14-5(3)6/h3-6H,1-2H2/t3-,4-,5-,6-/m1/s1 |
| InChIKey | MOYKHGMNXAOIAT-KVTDHHQDSA-N |
| Density | 1.652g/cm3 (Cal.) |
|---|---|
| Boiling point | 365.945°C at 760 mmHg (Cal.) |
| Flash point | 186.592°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,4:3,6-Dianhydro-D-Mannitol Dinitrate |