|
CAS#: 55153-17-8 Product: 2-Oxo-2-Phenylethyl 3-(Dimethylamino)Benzoate No suppilers available for the product. |
| Name | 2-Oxo-2-Phenylethyl 3-(Dimethylamino)Benzoate |
|---|---|
| Synonyms | 2-Oxo-2-phenylethyl 3-(dimethylamino)benzoate # |
| Molecular Structure | ![]() |
| Molecular Formula | C17H17NO3 |
| Molecular Weight | 283.32 |
| CAS Registry Number | 55153-17-8 |
| SMILES | O=C(c1ccccc1)COC(=O)c2cc(N(C)C)ccc2 |
| InChI | 1S/C17H17NO3/c1-18(2)15-10-6-9-14(11-15)17(20)21-12-16(19)13-7-4-3-5-8-13/h3-11H,12H2,1-2H3 |
| InChIKey | QVQZYNUIIKYFEE-UHFFFAOYSA-N |
| Density | 1.174g/cm3 (Cal.) |
|---|---|
| Boiling point | 461.811°C at 760 mmHg (Cal.) |
| Flash point | 233.095°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Oxo-2-Phenylethyl 3-(Dimethylamino)Benzoate |