|
CAS#: 55180-24-0 Product: 3,3,17,17-Bis(Ethylenedioxy)-5,10-Oxidoestr-9(11)-Ene No suppilers available for the product. |
| Name | 3,3,17,17-Bis(Ethylenedioxy)-5,10-Oxidoestr-9(11)-Ene |
|---|---|
| Synonyms | Estr-9(11)-Ene-3,17-Dione, 5,10-Epoxy-, Cyclic Bis(1,2-Ethanediyl Acetal), (5Alpha,10Alpha)-; (5Alpha,10Alpha)-5,10-Epoxyestr-9(11)-Ene-3,17-Dione Cyclic Bis(1,2-Ethanediyl Acetal); 3,3,17,17-Bis(Ethylenedioxy)-5,10-Oxidoestr-9(11)-Ene |
| Molecular Structure | ![]() |
| Molecular Formula | C22H30O5 |
| Molecular Weight | 374.48 |
| CAS Registry Number | 55180-24-0 |
| SMILES | [C@]127O[C@]1(CC[C@@H]3C2=CC[C@]4([C@H]3CCC45OCCO5)C)CC6(OCCO6)CC7 |
| InChI | 1S/C22H30O5/c1-18-5-3-17-15(16(18)4-7-22(18)25-12-13-26-22)2-6-19-14-20(23-10-11-24-20)8-9-21(17,19)27-19/h3,15-16H,2,4-14H2,1H3/t15-,16-,18-,19+,21+/m0/s1 |
| InChIKey | ZFJGUFKEIAMGEH-XJEZRWEYSA-N |
| Density | 1.313g/cm3 (Cal.) |
|---|---|
| Boiling point | 525.51°C at 760 mmHg (Cal.) |
| Flash point | 216.656°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,3,17,17-Bis(Ethylenedioxy)-5,10-Oxidoestr-9(11)-Ene |