|
CAS#: 55191-54-3 Product: Trimethylsilyl 5-[Bis(Trimethylsilyl)Amino]Pentanoate No suppilers available for the product. |
| Name | Trimethylsilyl 5-[Bis(Trimethylsilyl)Amino]Pentanoate |
|---|---|
| Synonyms | Trimethylsilyl 5-[bis(trimethylsilyl)amino]pentanoate # |
| Molecular Structure | ![]() |
| Molecular Formula | C14H35NO2Si3 |
| Molecular Weight | 333.69 |
| CAS Registry Number | 55191-54-3 |
| SMILES | O=C(O[Si](C)(C)C)CCCCN([Si](C)(C)C)[Si](C)(C)C |
| InChI | 1S/C14H35NO2Si3/c1-18(2,3)15(19(4,5)6)13-11-10-12-14(16)17-20(7,8)9/h10-13H2,1-9H3 |
| InChIKey | VSQRUIYDTHLALN-UHFFFAOYSA-N |
| Density | 0.884g/cm3 (Cal.) |
|---|---|
| Boiling point | 319.392°C at 760 mmHg (Cal.) |
| Flash point | 146.963°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Trimethylsilyl 5-[Bis(Trimethylsilyl)Amino]Pentanoate |