Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
|
+86 13417589054//+86 13424336463 | |||
|
info@atomaxchem.com,atomax.chemicals@gmail.com, | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | Tert-Butyl N-[(1R,3S)-3-Formylcyclopentyl]Carbamate |
|---|---|
| Synonyms | tert-butyl ((1R,3S)-3-formylcyclopentyl)carbamate |
| Molecular Structure | ![CAS#: 551964-49-9, Tert-Butyl N-[(1R,3S)-3-Formylcyclopentyl]Carbamate](/moreStructures/551964-49-9.gif) |
| Molecular Formula | C11H19NO3 |
| Molecular Weight | 213.27 |
| CAS Registry Number | 551964-49-9 |
| SMILES | CC(C)(C)OC(=O)N[C@H]1C[C@H](CC1)C=O |
| InChI | 1S/C11H19NO3/c1-11(2,3)15-10(14)12-9-5-4-8(6-9)7-13/h7-9H,4-6H2,1-3H3,(H,12,14)/t8-,9+/m0/s1 |
| InChIKey | QZIAFYMLFHEMJA-DTWKUNHWSA-N |
| Density | 1.057g/cm3 (Cal.) |
|---|---|
| Boiling point | 322.366°C at 760 mmHg (Cal.) |
| Flash point | 148.762°C (Cal.) |
| Refractive index | 1.474 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Tert-Butyl N-[(1R,3S)-3-Formylcyclopentyl]Carbamate |