|
CAS#: 55225-96-2 Product: 1-(2,2-Dichloro-1,1-Difluoroethoxy)-4-Isocyanatobenzene No suppilers available for the product. |
| Name | 1-(2,2-Dichloro-1,1-Difluoroethoxy)-4-Isocyanatobenzene |
|---|---|
| Synonyms | 1-(2,2-Dichloro-1,1-Difluoro-Ethoxy)-4-Isocyanato-Benzene |
| Molecular Structure | ![]() |
| Molecular Formula | C9H5Cl2F2NO2 |
| Molecular Weight | 268.05 |
| CAS Registry Number | 55225-96-2 |
| EINECS | 259-538-1 |
| SMILES | O=C=NC1=CC=C(OC(F)(F)C(Cl)Cl)C=C1 |
| InChI | 1S/C9H5Cl2F2NO2/c10-8(11)9(12,13)16-7-3-1-6(2-4-7)14-5-15/h1-4,8H |
| InChIKey | QHTKVCGDWAOTGS-UHFFFAOYSA-N |
| Density | 1.431g/cm3 (Cal.) |
|---|---|
| Boiling point | 286.093°C at 760 mmHg (Cal.) |
| Flash point | 126.825°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(2,2-Dichloro-1,1-Difluoroethoxy)-4-Isocyanatobenzene |