Online Database of Chemicals from Around the World
|
CAS#: 55255-59-9 Product: 2,6-Dimethyl-7-Octyl-1,2,3,4-Tetrahydronaphthalene No suppilers available for the product. |
| Name | 2,6-Dimethyl-7-Octyl-1,2,3,4-Tetrahydronaphthalene |
|---|---|
| Synonyms | 1,2,3,4-Tetrahydro-2,6-dimethyl-7-octylnaphthalene; 2,6-Dimethyl-7-octyl-1,2,3,4-tetrahydronaphthalene #; 2,6-Dimethyl-7-octyltetralin |
| Molecular Structure |  |
| Molecular Formula | C20H32 |
| Molecular Weight | 272.47 |
| CAS Registry Number | 55255-59-9 |
| SMILES | c1(c(cc2c(c1)CC(CC2)C)C)CCCCCCCC |
| InChI | 1S/C20H32/c1-4-5-6-7-8-9-10-18-15-20-13-16(2)11-12-19(20)14-17(18)3/h14-16H,4-13H2,1-3H3 |
| InChIKey | QXCGTKPQXLLOQZ-UHFFFAOYSA-N |
| Density | 0.895g/cm3 (Cal.) |
|---|---|
| Boiling point | 373.907°C at 760 mmHg (Cal.) |
| Flash point | 181.268°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,6-Dimethyl-7-Octyl-1,2,3,4-Tetrahydronaphthalene |