|
CAS#: 55255-72-6 Product: 4,4''-Diethyl-5'-(4-Ethylphenyl)-1,1':3',1''-Terbenzene No suppilers available for the product. |
| Name | 4,4''-Diethyl-5'-(4-Ethylphenyl)-1,1':3',1''-Terbenzene |
|---|---|
| Synonyms | Nsc364091; 1,1':3',1''-Terphenyl, 4,4''-Diethyl-5'-(4-Ethylphenyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C30H30 |
| Molecular Weight | 390.57 |
| CAS Registry Number | 55255-72-6 |
| SMILES | C1=CC(=CC=C1CC)C2=CC(=CC(=C2)C3=CC=C(C=C3)CC)C4=CC=C(C=C4)CC |
| InChI | 1S/C30H30/c1-4-22-7-13-25(14-8-22)28-19-29(26-15-9-23(5-2)10-16-26)21-30(20-28)27-17-11-24(6-3)12-18-27/h7-21H,4-6H2,1-3H3 |
| InChIKey | BUYBVSFUTSYONA-UHFFFAOYSA-N |
| Density | 1.018g/cm3 (Cal.) |
|---|---|
| Boiling point | 527.8°C at 760 mmHg (Cal.) |
| Flash point | 274.322°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,4''-Diethyl-5'-(4-Ethylphenyl)-1,1':3',1''-Terbenzene |