|
CAS#: 55256-57-0 Product: (3aS-cis)-3a,12a-Dihydro-4,6-dihydroxy-9-(3-hydroxy-3-methylbutyl)-5H-Furo(3',2':4,5)furo(3,2-b)xanthen-5-one No suppilers available for the product. |
| Name | (3aS-cis)-3a,12a-Dihydro-4,6-dihydroxy-9-(3-hydroxy-3-methylbutyl)-5H-Furo(3',2':4,5)furo(3,2-b)xanthen-5-one |
|---|---|
| Synonyms | Austocystin B; Brn 5168709; Ccris 2006 |
| Molecular Structure | ![]() |
| Molecular Formula | C22H20O7 |
| Molecular Weight | 396.40 |
| CAS Registry Number | 55256-57-0 |
| SMILES | [C@@H]15[C@@H](OC2=CC3=C(C(=C12)O)C(=O)C4=C(O3)C(=CC=C4O)CCC(O)(C)C)OC=C5 |
| InChI | 1S/C22H20O7/c1-22(2,26)7-5-10-3-4-12(23)16-19(25)17-14(28-20(10)16)9-13-15(18(17)24)11-6-8-27-21(11)29-13/h3-4,6,8-9,11,21,23-24,26H,5,7H2,1-2H3/t11-,21+/m0/s1 |
| InChIKey | JWPAJVNQGTWPMI-WIUDPPPLSA-N |
| Density | 1.473g/cm3 (Cal.) |
|---|---|
| Boiling point | 619.997°C at 760 mmHg (Cal.) |
| Flash point | 221.047°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (3aS-cis)-3a,12a-Dihydro-4,6-dihydroxy-9-(3-hydroxy-3-methylbutyl)-5H-Furo(3',2':4,5)furo(3,2-b)xanthen-5-one |