|
CAS#: 552883-91-7 Product: 4-(3-Fluoro-4-Nitrobenzyl)Morpholine No suppilers available for the product. |
| Name | 4-(3-Fluoro-4-Nitrobenzyl)Morpholine |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C11H13FN2O3 |
| Molecular Weight | 240.23 |
| CAS Registry Number | 552883-91-7 |
| SMILES | [O-][N+](=O)c1ccc(cc1F)CN2CCOCC2 |
| InChI | 1S/C11H13FN2O3/c12-10-7-9(1-2-11(10)14(15)16)8-13-3-5-17-6-4-13/h1-2,7H,3-6,8H2 |
| InChIKey | ACIOGCCQBJMRIE-UHFFFAOYSA-N |
| Density | 1.313g/cm3 (Cal.) |
|---|---|
| Boiling point | 355.685°C at 760 mmHg (Cal.) |
| Flash point | 168.913°C (Cal.) |
| Refractive index | 1.562 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(3-Fluoro-4-Nitrobenzyl)Morpholine |