|
CAS#: 55306-08-6 Product: Phantomolin No suppilers available for the product. |
| Name | Phantomolin |
|---|---|
| Synonyms | 2-Propenoic Acid, 2-Methyl-, 8-Ethoxy-2,3,3A,4,5,8,11,11A-Octahydro-6,10-Dimethyl-3-Methylene-2-Oxo-8,11-Epoxycyclodeca(B)Furan-4-Yl Ester, (3Ar-(3Ar*,4S*,6Z,8S*,11S*,11As*))-; C09527; Phantomolin |
| Molecular Structure | ![]() |
| Molecular Formula | C21H26O6 |
| Molecular Weight | 374.43 |
| CAS Registry Number | 55306-08-6 |
| SMILES | [C@H]12OC(=O)C([C@@H]1[C@@H](OC(=O)C(=C)C)CC(=C/[C@@]3(O[C@H]2C(=C3)C)OCC)\C)=C |
| InChI | 1S/C21H26O6/c1-7-24-21-9-12(4)8-15(25-19(22)11(2)3)16-14(6)20(23)26-18(16)17(27-21)13(5)10-21/h9-10,15-18H,2,6-8H2,1,3-5H3/b12-9-/t15-,16+,17-,18-,21-/m0/s1 |
| InChIKey | YNGLXZUKGYZCFL-YUZMFRNZSA-N |
| Density | 1.189g/cm3 (Cal.) |
|---|---|
| Boiling point | 517.791°C at 760 mmHg (Cal.) |
| Flash point | 225.527°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Phantomolin |