|
CAS#: 5532-23-0 Product: Jacozine No suppilers available for the product. |
| Name | Jacozine |
|---|---|
| Synonyms | Spiro((1,6)Dioxacyclododecino(2,3,4-Gh)Pyrrolizine-3(2H),2'-Oxirane)-2,7(4H)-Dione, 5,6,9,11,13,14,14A,14B-Octahydro-6-Hydroxy-3',6-Dimethyl-5-Methylene-, (3S,3'S,6R,14Ar,14Br)- |
| Molecular Structure | ![]() |
| Molecular Formula | C18H23NO6 |
| Molecular Weight | 349.38 |
| CAS Registry Number | 5532-23-0 |
| SMILES | [C@]14(O[C@H]1C)C(O[C@H]3[C@H]2C(=CCN2CC3)COC([C@@](C(C4)=C)(O)C)=O)=O |
| InChI | 1S/C18H23NO6/c1-10-8-18(11(2)25-18)16(21)24-13-5-7-19-6-4-12(14(13)19)9-23-15(20)17(10,3)22/h4,11,13-14,22H,1,5-9H2,2-3H3/t11-,13+,14+,17+,18-/m0/s1 |
| InChIKey | XCEPKQNOWNOSFH-CGPXFRKCSA-N |
| Density | 1.36g/cm3 (Cal.) |
|---|---|
| Boiling point | 586.133°C at 760 mmHg (Cal.) |
| Flash point | 308.282°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Jacozine |