|
CAS#: 5537-72-4 Product: 3-(Phenylthio)Benzoic Acid No suppilers available for the product. |
| Name | 3-(Phenylthio)Benzoic Acid |
|---|---|
| Synonyms | 3-(Phenylthio)Benzoic Acid; Nsc113994; Nsc 113994 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H10O2S |
| Molecular Weight | 230.28 |
| CAS Registry Number | 5537-72-4 |
| SMILES | C2=C(SC1=CC=CC=C1)C=CC=C2C(O)=O |
| InChI | 1S/C13H10O2S/c14-13(15)10-5-4-8-12(9-10)16-11-6-2-1-3-7-11/h1-9H,(H,14,15) |
| InChIKey | WMPJADCISOEVQV-UHFFFAOYSA-N |
| Density | 1.315g/cm3 (Cal.) |
|---|---|
| Boiling point | 424.79°C at 760 mmHg (Cal.) |
| Flash point | 210.706°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(Phenylthio)Benzoic Acid |