|
CAS#: 5544-20-7 Product: 1,2,3,10,11,11alpha-Hexahydro-5H-Pyrrolo(2,1-c)(1,4)Benzodiazepin-5-One No suppilers available for the product. |
| Name | 1,2,3,10,11,11alpha-Hexahydro-5H-Pyrrolo(2,1-c)(1,4)Benzodiazepin-5-One |
|---|---|
| Synonyms | 1,2,3,10,11,11A-Hexahydro-5H-Pyrrolo(2,1-C)(1,4)Benzodiazepin-5-One; 5H-Pyrrolo(2,1-C)(1,4)Benzodiazepin-5-One, 1,2,3,10,11,11A-Hexahydro- |
| Molecular Structure | ![]() |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 |
| CAS Registry Number | 5544-20-7 |
| SMILES | C2=C1C(=O)N3C(CNC1=CC=C2)CCC3 |
| InChI | 1S/C12H14N2O/c15-12-10-5-1-2-6-11(10)13-8-9-4-3-7-14(9)12/h1-2,5-6,9,13H,3-4,7-8H2 |
| InChIKey | HYPFMFLAOOULNZ-UHFFFAOYSA-N |
| Density | 1.243g/cm3 (Cal.) |
|---|---|
| Boiling point | 403.034°C at 760 mmHg (Cal.) |
| Flash point | 197.548°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,3,10,11,11alpha-Hexahydro-5H-Pyrrolo(2,1-c)(1,4)Benzodiazepin-5-One |