|
CAS#: 55493-64-6 Product: 2-[(2E)-2-Buten-2-Yl]-1,4,5,6-Tetrachloro-7,7-Dimethoxybicyclo[2.2.1]Hept-2-Ene No suppilers available for the product. |
| Name | 2-[(2E)-2-Buten-2-Yl]-1,4,5,6-Tetrachloro-7,7-Dimethoxybicyclo[2.2.1]Hept-2-Ene |
|---|---|
| Synonyms | 1,4,5,6-T |
| Molecular Structure | ![]() |
| Molecular Formula | C13H16Cl4O2 |
| Molecular Weight | 346.08 |
| CAS Registry Number | 55493-64-6 |
| SMILES | ClC2C1(Cl)/C=C(/C(=C/C)C)C(Cl)(C1(OC)OC)C2Cl |
| InChI | 1S/C13H16Cl4O2/c1-5-7(2)8-6-11(16)9(14)10(15)12(8,17)13(11,18-3)19-4/h5-6,9-10H,1-4H3/b7-5+ |
| InChIKey | FKDDBMQLQHIRSL-FNORWQNLSA-N |
| Density | 1.369g/cm3 (Cal.) |
|---|---|
| Boiling point | 396.61°C at 760 mmHg (Cal.) |
| Flash point | 135.157°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[(2E)-2-Buten-2-Yl]-1,4,5,6-Tetrachloro-7,7-Dimethoxybicyclo[2.2.1]Hept-2-Ene |