|
CAS#: 55493-86-2 Product: 5'-Methoxy-1'H-5alpha-Cholest-2-Eno[3,2-b]Indole No suppilers available for the product. |
| Name | 5'-Methoxy-1'H-5alpha-Cholest-2-Eno[3,2-b]Indole |
|---|---|
| Synonyms | 1'H-Cholest-2-Eno[3,2-B]Indole, 5'-Methoxy-, (5.Alpha.)-; 1-(1,5-Dimethylhexyl)-10-Methoxy-12A,14A-Dimethyl-1,2,3,3A,3B,4,5,5A,6,7,12,12A,12B,13,14,14A-Hexadecahydrocyclopenta[5,6]Naphtho[2,1-B]Carbazole |
| Molecular Structure | ![]() |
| Molecular Formula | C34H51NO |
| Molecular Weight | 489.78 |
| CAS Registry Number | 55493-86-2 |
| SMILES | C1=C(C=CC6=C1C5=C(CC4C(C2C(C3C(CC2)(C(CC3)C(CCCC(C)C)C)C)CC4)(C5)C)[NH]6)OC |
| InChI | 1S/C34H51NO/c1-21(2)8-7-9-22(3)28-13-14-29-25-12-10-23-18-32-27(26-19-24(36-6)11-15-31(26)35-32)20-34(23,5)30(25)16-17-33(28,29)4/h11,15,19,21-23,25,28-30,35H,7-10,12-14,16-18,20H2,1-6H3 |
| InChIKey | YKXCYDVYYYGRBA-UHFFFAOYSA-N |
| Density | 1.03g/cm3 (Cal.) |
|---|---|
| Boiling point | 590.741°C at 760 mmHg (Cal.) |
| Flash point | 205.169°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5'-Methoxy-1'H-5alpha-Cholest-2-Eno[3,2-b]Indole |