|
CAS#: 55521-13-6 Product: 1-(4-Hydroxy-3-Methylcyclohexyl)-3-Phenylurea No suppilers available for the product. |
| Name | 1-(4-Hydroxy-3-Methylcyclohexyl)-3-Phenylurea |
|---|---|
| Synonyms | N-(4-Hydroxy-3-methylcyclohexyl)-N'-phenylurea; N-(4-Hydroxy-3-methylcyclohexyl)-N'-phenylurea # |
| Molecular Structure | ![]() |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.32 |
| CAS Registry Number | 55521-13-6 |
| SMILES | O=C(NC1CCC(O)C(C)C1)Nc2ccccc2 |
| InChI | 1S/C14H20N2O2/c1-10-9-12(7-8-13(10)17)16-14(18)15-11-5-3-2-4-6-11/h2-6,10,12-13,17H,7-9H2,1H3,(H2,15,16,18) |
| InChIKey | XUCPPNIJOBIHJA-UHFFFAOYSA-N |
| Density | 1.158g/cm3 (Cal.) |
|---|---|
| Boiling point | 388.064°C at 760 mmHg (Cal.) |
| Flash point | 188.495°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(4-Hydroxy-3-Methylcyclohexyl)-3-Phenylurea |