|
CAS#: 55526-73-3 Product: O,O-Bis(4-Tert-Butylphenyl) N-Cyclohexylphosphoramidothioate No suppilers available for the product. |
| Name | O,O-Bis(4-Tert-Butylphenyl) N-Cyclohexylphosphoramidothioate |
|---|---|
| Synonyms | Bis(4-Tert-Butylphenoxy)-Cyclohexylimino-Sulfanyl-Phosphorane; Bis(4-Tert-Butylphenoxy)-Cyclohexylimino-Mercaptophosphorane; Bis(4-Tert-Butylphenoxy)-Cyclohexylimino-Mercapto-Phosphorane |
| Molecular Structure | ![]() |
| Molecular Formula | C26H38NO2PS |
| Molecular Weight | 459.63 |
| CAS Registry Number | 55526-73-3 |
| EINECS | 259-697-7 |
| SMILES | C1=CC(=CC=C1O[P](S)(OC2=CC=C(C=C2)C(C)(C)C)=NC3CCCCC3)C(C)(C)C |
| InChI | 1S/C26H38NO2PS/c1-25(2,3)20-12-16-23(17-13-20)28-30(31,27-22-10-8-7-9-11-22)29-24-18-14-21(15-19-24)26(4,5)6/h12-19,22,31H,7-11H2,1-6H3 |
| InChIKey | KGPGROHBUQZCPR-UHFFFAOYSA-N |
| Density | 1.101g/cm3 (Cal.) |
|---|---|
| Boiling point | 526.188°C at 760 mmHg (Cal.) |
| Flash point | 272.029°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for O,O-Bis(4-Tert-Butylphenyl) N-Cyclohexylphosphoramidothioate |