|
CAS#: 55557-10-3 Product: Trimethylsilyl 4-[Bis(Trimethylsilyl)Amino]-2-[(Trimethylsilyl)Amino]Butanoate No suppilers available for the product. |
| Name | Trimethylsilyl 4-[Bis(Trimethylsilyl)Amino]-2-[(Trimethylsilyl)Amino]Butanoate |
|---|---|
| Synonyms | Trimethyl |
| Molecular Structure | ![]() |
| Molecular Formula | C16H42N2O2Si4 |
| Molecular Weight | 406.86 |
| CAS Registry Number | 55557-10-3 |
| SMILES | O=C(O[Si](C)(C)C)C(N[Si](C)(C)C)CCN([Si](C)(C)C)[Si](C)(C)C |
| InChI | 1S/C16H42N2O2Si4/c1-21(2,3)17-15(16(19)20-24(10,11)12)13-14-18(22(4,5)6)23(7,8)9/h15,17H,13-14H2,1-12H3 |
| InChIKey | ILGLPGYMCFETOI-UHFFFAOYSA-N |
| Density | 0.893g/cm3 (Cal.) |
|---|---|
| Boiling point | 365.251°C at 760 mmHg (Cal.) |
| Flash point | 174.698°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Trimethylsilyl 4-[Bis(Trimethylsilyl)Amino]-2-[(Trimethylsilyl)Amino]Butanoate |