|
CAS#: 55610-02-1 Product: 1,2-Dimethoxy-6-Methyl-4H-Dibenzo[de,g]Quinoline-4,5(6H)-Dione No suppilers available for the product. |
| Name | 1,2-Dimethoxy-6-Methyl-4H-Dibenzo[de,g]Quinoline-4,5(6H)-Dione |
|---|---|
| Synonyms | Aids-224743; Aids224743; Cepharadione B |
| Molecular Structure | ![]() |
| Molecular Formula | C19H15NO4 |
| Molecular Weight | 321.33 |
| CAS Registry Number | 55610-02-1 |
| SMILES | C4=C2C(C(N(C3=CC1=C(C=CC=C1)C(=C23)C(=C4OC)OC)C)=O)=O |
| InChI | 1S/C19H15NO4/c1-20-13-8-10-6-4-5-7-11(10)16-15(13)12(17(21)19(20)22)9-14(23-2)18(16)24-3/h4-9H,1-3H3 |
| InChIKey | AFKGBLKLNRDQFN-UHFFFAOYSA-N |
| Density | 1.346g/cm3 (Cal.) |
|---|---|
| Boiling point | 573.949°C at 760 mmHg (Cal.) |
| Flash point | 300.914°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2-Dimethoxy-6-Methyl-4H-Dibenzo[de,g]Quinoline-4,5(6H)-Dione |