|
CAS#: 55669-89-1 Product: 5-(2,5-Dimethylphenyl)-4-Methyl-2(3H)-Furanone No suppilers available for the product. |
| Name | 5-(2,5-Dimethylphenyl)-4-Methyl-2(3H)-Furanone |
|---|---|
| Synonyms | 5-(2,5-Dimethylphenyl)-4-methyl-2(3H)-furanone # |
| Molecular Structure | ![]() |
| Molecular Formula | C13H14O2 |
| Molecular Weight | 202.25 |
| CAS Registry Number | 55669-89-1 |
| SMILES | O=C2O/C(c1c(ccc(c1)C)C)=C(/C)C2 |
| InChI | 1S/C13H14O2/c1-8-4-5-9(2)11(6-8)13-10(3)7-12(14)15-13/h4-6H,7H2,1-3H3 |
| InChIKey | YSGQGJXAHGKEIC-UHFFFAOYSA-N |
| Density | 1.11g/cm3 (Cal.) |
|---|---|
| Boiling point | 393.055°C at 760 mmHg (Cal.) |
| Flash point | 165.443°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-(2,5-Dimethylphenyl)-4-Methyl-2(3H)-Furanone |