|
CAS#: 55684-92-9 Product: 1,2,3,5-Tetrachloro-4-(3,4,5-trichlorophenoxy)benzene No suppilers available for the product. |
| Name | 1,2,3,5-Tetrachloro-4-(3,4,5-trichlorophenoxy)benzene |
|---|---|
| Synonyms | Ether, Heptachlorodiphenyl; Heptachlorodiphenyl Ether; Heptachloro Diphenyl Ether |
| Molecular Structure | ![]() |
| Molecular Formula | C12H3Cl7O |
| Molecular Weight | 411.33 |
| CAS Registry Number | 55684-92-9 |
| SMILES | C1=C(C(=C(Cl)C(=C1Cl)Cl)OC2=CC(=C(C(=C2)Cl)Cl)Cl)Cl |
| InChI | 1S/C12H3Cl7O/c13-5-1-4(2-6(14)9(5)17)20-12-8(16)3-7(15)10(18)11(12)19/h1-3H |
| InChIKey | YUBXSCDZYOJXNX-UHFFFAOYSA-N |
| Density | 1.688g/cm3 (Cal.) |
|---|---|
| Boiling point | 419.49°C at 760 mmHg (Cal.) |
| Flash point | 146.841°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,3,5-Tetrachloro-4-(3,4,5-trichlorophenoxy)benzene |