Online Database of Chemicals from Around the World
|
CAS#: 55702-41-5 Product: 1,1'-(Methoxymethylene)Bis(4-Chlorobenzene) No suppilers available for the product. |
| Name | 1,1'-(Methoxymethylene)Bis(4-Chlorobenzene) |
|---|---|
| Synonyms | 1-Chloro-4-[(4-Chlorophenyl)-Methoxy-Methyl]Benzene; Benzene, 1,1'-(Methoxymethylene)Bis*4-Chloro-; Benzene, 1,1'-(Methoxymethylene)Bis[4-Chloro- |
| Molecular Structure |  |
| Molecular Formula | C14H12Cl2O |
| Molecular Weight | 267.15 |
| CAS Registry Number | 55702-41-5 |
| SMILES | C2=C(C(C1=CC=C(Cl)C=C1)OC)C=CC(=C2)Cl |
| InChI | 1S/C14H12Cl2O/c1-17-14(10-2-6-12(15)7-3-10)11-4-8-13(16)9-5-11/h2-9,14H,1H3 |
| InChIKey | CEJVQEAKGWJHNK-UHFFFAOYSA-N |
| Density | 1.235g/cm3 (Cal.) |
|---|---|
| Boiling point | 338.72°C at 760 mmHg (Cal.) |
| Flash point | 83.197°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1'-(Methoxymethylene)Bis(4-Chlorobenzene) |