|
CAS#: 55702-50-6 Product: 2-Acetamido-4-Chlorophenyl Acetate No suppilers available for the product. |
| Name | 2-Acetamido-4-Chlorophenyl Acetate |
|---|---|
| Synonyms | 2-(Acetylamino)-4-chlorophenyl acetate; 2-(Acetylamino)-4-chlorophenyl acetate # |
| Molecular Structure | ![]() |
| Molecular Formula | C10H10ClNO3 |
| Molecular Weight | 227.64 |
| CAS Registry Number | 55702-50-6 |
| SMILES | Clc1cc(c(OC(=O)C)cc1)NC(=O)C |
| InChI | 1S/C10H10ClNO3/c1-6(13)12-9-5-8(11)3-4-10(9)15-7(2)14/h3-5H,1-2H3,(H,12,13) |
| InChIKey | DULSSOFSGOSBSS-UHFFFAOYSA-N |
| Density | 1.323g/cm3 (Cal.) |
|---|---|
| Boiling point | 392.477°C at 760 mmHg (Cal.) |
| Flash point | 191.164°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Acetamido-4-Chlorophenyl Acetate |