|
CAS#: 55720-38-2 Product: 1,3,8-Trichloronaphthalene No suppilers available for the product. |
| Name | 1,3,8-Trichloronaphthalene |
|---|---|
| Synonyms | Naphthalene, 1,3,8-Trichloro-; Naphthalene, 1,3,8-Trichloro |
| Molecular Structure | ![]() |
| Molecular Formula | C10H5Cl3 |
| Molecular Weight | 231.51 |
| CAS Registry Number | 55720-38-2 |
| SMILES | C2=C(C1=C(C=C(C=C1C=C2)Cl)Cl)Cl |
| InChI | 1S/C10H5Cl3/c11-7-4-6-2-1-3-8(12)10(6)9(13)5-7/h1-5H |
| InChIKey | AXNCYYJNXAOOJQ-UHFFFAOYSA-N |
| Density | 1.452g/cm3 (Cal.) |
|---|---|
| Boiling point | 330.21°C at 760 mmHg (Cal.) |
| Flash point | 226.337°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3,8-Trichloronaphthalene |