|
CAS#: 55741-09-8 Product: 1,2,3,4-Tetrachloro-5-(phenylthio)benzene No suppilers available for the product. |
| Name | 1,2,3,4-Tetrachloro-5-(phenylthio)benzene |
|---|---|
| Synonyms | 1,2,3,4-Tetrachloro-5-Phenylsulfanyl-Benzene; 1,2,3,4-Tetrachloro-5-(Phenylthio)Benzene |
| Molecular Structure | ![]() |
| Molecular Formula | C12H6Cl4S |
| Molecular Weight | 324.05 |
| CAS Registry Number | 55741-09-8 |
| SMILES | C2=C(SC1=CC=CC=C1)C(=C(C(=C2Cl)Cl)Cl)Cl |
| InChI | 1S/C12H6Cl4S/c13-8-6-9(11(15)12(16)10(8)14)17-7-4-2-1-3-5-7/h1-6H |
| InChIKey | AHCGIRARGJAIPX-UHFFFAOYSA-N |
| Density | 1.552g/cm3 (Cal.) |
|---|---|
| Boiling point | 406.295°C at 760 mmHg (Cal.) |
| Flash point | 184.956°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,3,4-Tetrachloro-5-(phenylthio)benzene |