Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | S-(2,5-Dimethyl-3-Furyl) 3-Methylbutanethioate |
|---|---|
| Synonyms | S-[(2,5-Dimethyl-3-Furyl)] 3-Methylbutanethioate; 3-Methylbutanethioic Acid S-[(2,5-Dimethyl-3-Furyl)] Ester; 2,5-Dimethyl-3-Thioisovaleryl Furan |
| Molecular Structure |  |
| Molecular Formula | C11H16O2S |
| Molecular Weight | 212.31 |
| CAS Registry Number | 55764-28-8 |
| EINECS | 259-802-6 |
| FEMA | 3482 |
| SMILES | C1=C(OC(=C1SC(CC(C)C)=O)C)C |
| InChI | 1S/C11H16O2S/c1-7(2)5-11(12)14-10-6-8(3)13-9(10)4/h6-7H,5H2,1-4H3 |
| InChIKey | XFNLWIPNTYNNJX-UHFFFAOYSA-N |
| Density | 1.071g/cm3 (Cal.) |
|---|---|
| Boiling point | 277°C at 760 mmHg (Cal.) |
| 124-125°C (Expl.) | |
| Flash point | 121.326°C (Cal.) |
| Refractive index | 1.492-1.508 (Expl.) |
| Market Analysis Reports |
| List of Reports Available for S-(2,5-Dimethyl-3-Furyl) 3-Methylbutanethioate |