|
CAS#: 55780-80-8 Product: [Hydroxy-[(2R,3S,5R,6R)-2,3,4,5,6-Pentahydroxycyclohexyl]Oxy-Phosphoryl]Oxyphosphonic Acid No suppilers available for the product. |
| Name | [Hydroxy-[(2R,3S,5R,6R)-2,3,4,5,6-Pentahydroxycyclohexyl]Oxy-Phosphoryl]Oxyphosphonic Acid |
|---|---|
| Synonyms | D-Myo-Inositol, 1-(Trihydrogen Diphosphate); Inositol-1-Pyrophosphate; Myo-Inositol-1-Pyrophosphate |
| Molecular Structure | ![]() |
| Molecular Formula | C6H14O12P2 |
| Molecular Weight | 340.12 |
| CAS Registry Number | 55780-80-8 |
| SMILES | [C@@H]1(O)C(O[P](O[P](O)(O)=O)(O)=O)[C@@H](O)[C@@H](O)C(O)[C@H]1O |
| InChI | 1S/C6H14O12P2/c7-1-2(8)4(10)6(5(11)3(1)9)17-20(15,16)18-19(12,13)14/h1-11H,(H,15,16)(H2,12,13,14)/t1?,2-,3+,4-,5-,6?/m0/s1 |
| InChIKey | ZMHWIKBKXLNABI-LXOASSSBSA-N |
| Density | 2.157g/cm3 (Cal.) |
|---|---|
| Boiling point | 622.565°C at 760 mmHg (Cal.) |
| Flash point | 330.316°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [Hydroxy-[(2R,3S,5R,6R)-2,3,4,5,6-Pentahydroxycyclohexyl]Oxy-Phosphoryl]Oxyphosphonic Acid |