Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (650) 278-9963 | |||
|
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Name | Pyridindolol |
|---|---|
| Synonyms | 1-(3-Methylol-9H-$B-Carbolin-1-Yl)Ethane-1,2-Diol; K 251 Sb; Nsc266530 |
| Molecular Structure |  |
| Molecular Formula | C14H14N2O3 |
| Molecular Weight | 258.28 |
| CAS Registry Number | 55812-46-9 |
| SMILES | C1=C(N=C(C3=C1C2=CC=CC=C2[NH]3)C(O)CO)CO |
| InChI | 1S/C14H14N2O3/c17-6-8-5-10-9-3-1-2-4-11(9)16-13(10)14(15-8)12(19)7-18/h1-5,12,16-19H,6-7H2 |
| InChIKey | VAKXHGQDPLEUTH-UHFFFAOYSA-N |
| Density | 1.505g/cm3 (Cal.) |
|---|---|
| Boiling point | 604.33°C at 760 mmHg (Cal.) |
| Flash point | 319.287°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Pyridindolol |