|
CAS#: 55836-73-2 Product: 4,4-D2-Cyclophosphamide No suppilers available for the product. |
| Name | 4,4-D2-Cyclophosphamide |
|---|---|
| Synonyms | Bis(2-Chloroethyl)-(4,4-Dideuterio-2-Keto-1-Oxa-3-Aza-2$L^{5}-Phosphacyclohex-2-Yl)Amine; N,N-Bis(2-Chloroethyl)Tetrahydro-4-D-2H-1,3,2-Oxazaphosphorin-4-D-2-Amine 2-Oxide; 2H-1,3,2-Oxazaphosphorin-4-D-2-Amine, N,N-Bis(2-Chloroethyl)Tetrahydro-4-D-, 2-Oxide |
| Molecular Structure | ![]() |
| Molecular Formula | C7H13D2Cl2N2O2P |
| Molecular Weight | 263.10 |
| CAS Registry Number | 55836-73-2 |
| SMILES | C(N([P]1(OCCC(N1)([2H])[2H])=O)CCCl)CCl |
| InChI | 1S/C7H15Cl2N2O2P/c8-2-5-11(6-3-9)14(12)10-4-1-7-13-14/h1-7H2,(H,10,12)/i4D2 |
| InChIKey | CMSMOCZEIVJLDB-APZFVMQVSA-N |
| Density | 1.344g/cm3 (Cal.) |
|---|---|
| Boiling point | 336.099°C at 760 mmHg (Cal.) |
| Flash point | 157.068°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,4-D2-Cyclophosphamide |