Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (650) 278-9963 | |||
|
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Name | Xenipentone |
|---|---|
| Synonyms | 4-(4-Phenylphenyl)Pent-3-En-2-One; (E)-4-(4-Biphenylyl)-3-Penten-2-On; Rp 48-482 |
| Molecular Structure |  |
| Molecular Formula | C17H16O |
| Molecular Weight | 236.31 |
| CAS Registry Number | 55845-78-8 |
| SMILES | C2=C(C1=CC=CC=C1)C=CC(=C2)C(=C/C(C)=O)/C |
| InChI | 1S/C17H16O/c1-13(12-14(2)18)15-8-10-17(11-9-15)16-6-4-3-5-7-16/h3-12H,1-2H3/b13-12+ |
| InChIKey | AAOLGDRTKZMLIG-OUKQBFOZSA-N |
| Density | 1.031g/cm3 (Cal.) |
|---|---|
| Melting point | 132-134°C (Expl.) |
| Boiling point | 394.098°C at 760 mmHg (Cal.) |
| Flash point | 150.896°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Xenipentone |