|
CAS#: 5585-67-1 Product: Antipressine No suppilers available for the product. |
| Name | Antipressine |
|---|---|
| Synonyms | Reserpilin-24-Oic Acid, 2-(Dimethylamino)Ethyl Ester, Dihydrochloride; Reserpilinic Acid, 2-(Dimethylamino)Ethyl Ester (6Ci,7Ci) |
| Molecular Structure | ![]() |
| Molecular Formula | C26H35N3O5 |
| Molecular Weight | 469.58 |
| CAS Registry Number | 5585-67-1 |
| SMILES | [C@@H]45[C@@H](CN3[C@@H](C2=C(C1=CC(=C(OC)C=C1[NH]2)OC)CC3)C4)[C@@H](OC=C5C(OCCN(C)C)=O)C |
| InChI | 1S/C26H35N3O5/c1-15-19-13-29-7-6-16-18-11-23(31-4)24(32-5)12-21(18)27-25(16)22(29)10-17(19)20(14-34-15)26(30)33-9-8-28(2)3/h11-12,14-15,17,19,22,27H,6-10,13H2,1-5H3/t15-,17-,19-,22+/m0/s1 |
| InChIKey | GKMCARMHFZCZDR-MNNBHYOVSA-N |
| Density | 1.274g/cm3 (Cal.) |
|---|---|
| Boiling point | 614.661°C at 760 mmHg (Cal.) |
| Flash point | 325.536°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Antipressine |