|
CAS#: 55875-42-8 Product: N,N,3-Trimethyl-4-(2-Nitro-1-Propen-1-Yl)Aniline No suppilers available for the product. |
| Name | N,N,3-Trimethyl-4-(2-Nitro-1-Propen-1-Yl)Aniline |
|---|---|
| Synonyms | N,N-dimethyl-4-(2-nitro-1-propenyl)-m-toluidine; NSC304704 |
| Molecular Structure | ![]() |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 |
| CAS Registry Number | 55875-42-8 |
| EINECS | 259-874-9 |
| SMILES | [O-][N+](=O)C(=Cc1c(cc(N(C)C)cc1)C)C |
| InChI | 1S/C12H16N2O2/c1-9-7-12(13(3)4)6-5-11(9)8-10(2)14(15)16/h5-8H,1-4H3 |
| InChIKey | JVMSKGOQBHOVAB-UHFFFAOYSA-N |
| Density | 1.117g/cm3 (Cal.) |
|---|---|
| Boiling point | 359.912°C at 760 mmHg (Cal.) |
| Flash point | 171.469°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N,N,3-Trimethyl-4-(2-Nitro-1-Propen-1-Yl)Aniline |