|
CAS#: 5588-23-8 Product: Cypenamine No suppilers available for the product. |
| Name | Cypenamine |
|---|---|
| Synonyms | 2-Phenyl-1-Cyclopentanamine Hydrochloride; (2-Phenylcyclopentyl)Amine Hydrochloride; 2-Phenylcyclopentylamine Hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C11H16ClN |
| Molecular Weight | 197.71 |
| CAS Registry Number | 5588-23-8 |
| SMILES | [H+].C2=C(C1C(N)CCC1)C=CC=C2.[Cl-] |
| InChI | 1S/C11H15N.ClH/c12-11-8-4-7-10(11)9-5-2-1-3-6-9;/h1-3,5-6,10-11H,4,7-8,12H2;1H |
| InChIKey | FWIIHEJLRNKGDU-UHFFFAOYSA-N |
| Boiling point | 259.2°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 114.5°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Cypenamine |