| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (650) 278-9963 | |||
![]() |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Matrix Scientific Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (803) 788-9494 | |||
![]() |
sales@matrixscientific.com | |||
| Chemical manufacturer | ||||
| P and M Invest Ltd. | Russian Federation | Inquire | ||
|---|---|---|---|---|
![]() |
+7 (495) 135-6494 | |||
![]() |
sales@fluorine.ru | |||
| Chemical manufacturer | ||||
| Zylexa Pharma Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (845) 299-6009/ | |||
![]() |
sales@zylexa-pharma.com,enquiries@zylexa-pharma.com | |||
| Chemical manufacturer | ||||
| Name | Perfluorooctene-1 |
|---|---|
| Synonyms | Perfluorooct-1-Ene |
| Molecular Structure | ![]() |
| Molecular Formula | C8F16 |
| Molecular Weight | 400.06 |
| CAS Registry Number | 559-14-8 |
| EINECS | 209-202-5 |
| SMILES | C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(=C(F)F)F |
| InChI | 1S/C8F16/c9-1(2(10)11)3(12,13)4(14,15)5(16,17)6(18,19)7(20,21)8(22,23)24 |
| InChIKey | YCBPKOZNGFQMPB-UHFFFAOYSA-N |
| Density | 1.658g/cm3 (Cal.) |
|---|---|
| Boiling point | 102-105°C (Expl.) |
| 109.26°C at 760 mmHg (Cal.) | |
| Flash point | 29.578°C (Cal.) |
| Refractive index | 1.2802 (Expl.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Perfluorooctene-1 |