|
CAS#: 559-49-9 Product: Annotinine No suppilers available for the product. |
| Name | Annotinine |
|---|---|
| Synonyms | 4-27-00-06563 (Beilstein Handbook Reference); Annotinin; Brn 0030714 |
| Molecular Structure | ![]() |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 |
| CAS Registry Number | 559-49-9 |
| SMILES | [C@]246[C@]1(N(CCC[C@@H]1[C@H]3C[C@@H]2C(O3)=O)C[C@@H]5[C@H]4O5)CC6C |
| InChI | 1S/C16H21NO3/c1-8-6-15-9-3-2-4-17(15)7-12-13(19-12)16(8,15)10-5-11(9)20-14(10)18/h8-13H,2-7H2,1H3/t8?,9-,10-,11-,12-,13-,15+,16+/m1/s1 |
| InChIKey | MVITYUVPZPGMRM-RLFDSYHXSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 462.0±45.0°C at 760 mmHg (Cal.) |
| Flash point | 233.2±28.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Annotinine |