|
CAS#: 55901-79-6 Product: [2,3-Dichloro-4-(2-Thienylmethyl)Phenoxy]Acetic Acid No suppilers available for the product. |
| Name | [2,3-Dichloro-4-(2-Thienylmethyl)Phenoxy]Acetic Acid |
|---|---|
| Synonyms | 2-[2,3-Dichloro-4-(2-Thienylmethyl)Phenoxy]Acetic Acid; 2-[2,3-Dichloro-4-(Thiophen-2-Ylmethyl)Phenoxy]Ethanoic Acid; Anp 7155 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H10Cl2O3S |
| Molecular Weight | 317.19 |
| CAS Registry Number | 55901-79-6 |
| SMILES | C1=CC(=C(C(=C1CC2=CC=CS2)Cl)Cl)OCC(O)=O |
| InChI | 1S/C13H10Cl2O3S/c14-12-8(6-9-2-1-5-19-9)3-4-10(13(12)15)18-7-11(16)17/h1-5H,6-7H2,(H,16,17) |
| InChIKey | CAANODYIPBBLNZ-UHFFFAOYSA-N |
| Density | 1.459g/cm3 (Cal.) |
|---|---|
| Boiling point | 461.723°C at 760 mmHg (Cal.) |
| Flash point | 233.042°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [2,3-Dichloro-4-(2-Thienylmethyl)Phenoxy]Acetic Acid |